C19H19Br2N3O6 — CID 11918862
4-bromo-2-[(2R,3R,5R,6R)-6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol (PubChem CID 11918862) has the molecular formula C19H19Br2N3O6 and a molecular weight of 545.18 g/mol. Its IUPAC name is 4-bromo-2-[(2R,3R,5R,6R)-6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol.
| Compound Name | 4-bromo-2-[(2R,3R,5R,6R)-6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol |
|---|---|
| PubChem CID | 11918862 |
| Molecular Formula | C19H19Br2N3O6 |
| Molecular Weight | 545.18 g/mol |
| Exact Mass | 542.96 |
| IUPAC Name | 4-bromo-2-[(2R,3R,5R,6R)-6-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-3,5-dinitropiperidin-2-yl]phenol |
| SMILES | CC1(C)[C@@H]([N+](=O)[O-])[C@@H](c2cc(Br)ccc2O)N[C@H](c2cc(Br)ccc2O)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19Br2N3O6/c1-19(2)17(23(27)28)15(11-7-9(20)3-5-13(11)25)22-16(18(19)24(29)30)12-8-10(21)4-6-14(12)26/h3-8,15-18,22,25-26H,1-2H3/t15-,16-,17+,18+/m1/s1 |
| InChIKey | LGUYRGFXQNABSG-BDXSIMOUSA-N |
| XLogP | 4.33 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|