C20H22Br2N2O2 — CID 176729920
2-[(2R,3R,4aS,8aS)-3-(3-bromo-2-hydroxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-6-bromophenol (PubChem CID 176729920) has the molecular formula C20H22Br2N2O2 and a molecular weight of 482.22 g/mol. Its IUPAC name is 2-[(2R,3R,4aS,8aS)-3-(3-bromo-2-hydroxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-6-bromophenol.
| Compound Name | 2-[(2R,3R,4aS,8aS)-3-(3-bromo-2-hydroxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-6-bromophenol |
|---|---|
| PubChem CID | 176729920 |
| Molecular Formula | C20H22Br2N2O2 |
| Molecular Weight | 482.22 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 2-[(2R,3R,4aS,8aS)-3-(3-bromo-2-hydroxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]-6-bromophenol |
| SMILES | Oc1c(Br)cccc1[C@H]1N[C@H]2CCCC[C@@H]2N[C@@H]1c1cccc(Br)c1O |
| InChI | InChI=1S/C20H22Br2N2O2/c21-13-7-3-5-11(19(13)25)17-18(12-6-4-8-14(22)20(12)26)24-16-10-2-1-9-15(16)23-17/h3-8,15-18,23-26H,1-2,9-10H2/t15-,16-,17+,18+/m0/s1 |
| InChIKey | CPYPZKVGVZTOMN-WNRNVDISSA-N |
| XLogP | 4.91 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|