C21H18BrN3O2 — CID 102263404
2-[(2R,3S,4R,5S)-5-(4-bromophenyl)-3-nitro-4-phenylpyrrolidin-2-yl]pyridine (PubChem CID 102263404) has the molecular formula C21H18BrN3O2 and a molecular weight of 424.30 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5S)-5-(4-bromophenyl)-3-nitro-4-phenylpyrrolidin-2-yl]pyridine.
| Compound Name | 2-[(2R,3S,4R,5S)-5-(4-bromophenyl)-3-nitro-4-phenylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 102263404 |
| Molecular Formula | C21H18BrN3O2 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 2-[(2R,3S,4R,5S)-5-(4-bromophenyl)-3-nitro-4-phenylpyrrolidin-2-yl]pyridine |
| SMILES | O=[N+]([O-])[C@H]1[C@H](c2ccccc2)[C@@H](c2ccc(Br)cc2)N[C@H]1c1ccccn1 |
| InChI | InChI=1S/C21H18BrN3O2/c22-16-11-9-15(10-12-16)19-18(14-6-2-1-3-7-14)21(25(26)27)20(24-19)17-8-4-5-13-23-17/h1-13,18-21,24H/t18-,19-,20+,21+/m1/s1 |
| InChIKey | BHVIYRCIRFOUSR-CGXNFDGLSA-N |
| XLogP | 4.66 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|