C23H20N2O3 — CID 164666937
(4-nitro-3,5-diphenylpyrrolidin-2-yl)-phenylmethanone (PubChem CID 164666937) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is (4-nitro-3,5-diphenylpyrrolidin-2-yl)-phenylmethanone.
| Compound Name | (4-nitro-3,5-diphenylpyrrolidin-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 164666937 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (4-nitro-3,5-diphenylpyrrolidin-2-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1NC(c2ccccc2)C([N+](=O)[O-])C1c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3/c26-23(18-14-8-3-9-15-18)21-19(16-10-4-1-5-11-16)22(25(27)28)20(24-21)17-12-6-2-7-13-17/h1-15,19-22,24H |
| InChIKey | HUSSIZOBLGXNPP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|