C21H16N2O3 — CID 23266933
[(2R,3S)-3-(4-nitrophenyl)aziridin-2-yl]-(4-phenylphenyl)methanone (PubChem CID 23266933) has the molecular formula C21H16N2O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is [(2R,3S)-3-(4-nitrophenyl)aziridin-2-yl]-(4-phenylphenyl)methanone.
| Compound Name | [(2R,3S)-3-(4-nitrophenyl)aziridin-2-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 23266933 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(2R,3S)-3-(4-nitrophenyl)aziridin-2-yl]-(4-phenylphenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)[C@@H]1N[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16N2O3/c24-21(17-8-6-15(7-9-17)14-4-2-1-3-5-14)20-19(22-20)16-10-12-18(13-11-16)23(25)26/h1-13,19-20,22H/t19-,20+/m0/s1 |
| InChIKey | UBOBDPUFSFFGIV-VQTJNVASSA-N |
| XLogP | 4.16 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|