C26H24N2O5 — CID 70864332
4-benzoyl-2-methyl-5-(4-methylphenyl)-3-(4-nitrophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 70864332) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-benzoyl-2-methyl-5-(4-methylphenyl)-3-(4-nitrophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-benzoyl-2-methyl-5-(4-methylphenyl)-3-(4-nitrophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70864332 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 4-benzoyl-2-methyl-5-(4-methylphenyl)-3-(4-nitrophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(C2NC(C)(C(=O)O)C(c3ccc([N+](=O)[O-])cc3)C2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O5/c1-16-8-10-18(11-9-16)23-21(24(29)19-6-4-3-5-7-19)22(26(2,27-23)25(30)31)17-12-14-20(15-13-17)28(32)33/h3-15,21-23,27H,1-2H3,(H,30,31) |
| InChIKey | MRRHYZUZMLQEBA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|