C21H19NO4 — CID 71654799
[(1R,2S,3R,4S)-4-ethyl-3-(4-nitrophenyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]-phenylmethanone (PubChem CID 71654799) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is [(1R,2S,3R,4S)-4-ethyl-3-(4-nitrophenyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]-phenylmethanone.
| Compound Name | [(1R,2S,3R,4S)-4-ethyl-3-(4-nitrophenyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 71654799 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [(1R,2S,3R,4S)-4-ethyl-3-(4-nitrophenyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]-phenylmethanone |
| SMILES | CC[C@@]12C=C[C@@H](O1)[C@@H](C(=O)c1ccccc1)[C@@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19NO4/c1-2-21-13-12-17(26-21)18(20(23)15-6-4-3-5-7-15)19(21)14-8-10-16(11-9-14)22(24)25/h3-13,17-19H,2H2,1H3/t17-,18-,19+,21+/m1/s1 |
| InChIKey | DAJBYLUBGUBPJS-BNDYYXHWSA-N |
| XLogP | 4.29 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|