C20H17NO5 — CID 11484926
1-[(2S,3S)-2-benzoyl-5-methyl-3-(4-nitrophenyl)-2,3-dihydrofuran-4-yl]ethanone (PubChem CID 11484926) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 1-[(2S,3S)-2-benzoyl-5-methyl-3-(4-nitrophenyl)-2,3-dihydrofuran-4-yl]ethanone.
| Compound Name | 1-[(2S,3S)-2-benzoyl-5-methyl-3-(4-nitrophenyl)-2,3-dihydrofuran-4-yl]ethanone |
|---|---|
| PubChem CID | 11484926 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-[(2S,3S)-2-benzoyl-5-methyl-3-(4-nitrophenyl)-2,3-dihydrofuran-4-yl]ethanone |
| SMILES | CC(=O)C1=C(C)O[C@H](C(=O)c2ccccc2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H17NO5/c1-12(22)17-13(2)26-20(19(23)15-6-4-3-5-7-15)18(17)14-8-10-16(11-9-14)21(24)25/h3-11,18,20H,1-2H3/t18-,20-/m0/s1 |
| InChIKey | QBWZICTVVWJKMF-ICSRJNTNSA-N |
| XLogP | 3.82 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|