C27H16ClF8NO6S — CID 71440412
[4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-3-(4-nitrophenyl)-5-phenyl-2,3-dihydrofuran-2-yl]-phenylmethanone (PubChem CID 71440412) has the molecular formula C27H16ClF8NO6S and a molecular weight of 669.93 g/mol. Its IUPAC name is [4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-3-(4-nitrophenyl)-5-phenyl-2,3-dihydrofuran-2-yl]-phenylmethanone.
| Compound Name | [4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-3-(4-nitrophenyl)-5-phenyl-2,3-dihydrofuran-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 71440412 |
| Molecular Formula | C27H16ClF8NO6S |
| Molecular Weight | 669.93 g/mol |
| Exact Mass | 669.03 |
| IUPAC Name | [4-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)sulfonyl-3-(4-nitrophenyl)-5-phenyl-2,3-dihydrofuran-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1OC(c2ccccc2)=C(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H16ClF8NO6S/c28-26(33,34)24(29,30)25(31,32)27(35,36)44(41,42)23-19(15-11-13-18(14-12-15)37(39)40)22(20(38)16-7-3-1-4-8-16)43-21(23)17-9-5-2-6-10-17/h1-14,19,22H |
| InChIKey | UMHURCHQQMPJHE-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.93 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|