C15H11N3O5 — CID 12650827
(4-nitrophenyl)-[(2S,3R)-3-(4-nitrophenyl)aziridin-2-yl]methanone (PubChem CID 12650827) has the molecular formula C15H11N3O5 and a molecular weight of 313.27 g/mol. Its IUPAC name is (4-nitrophenyl)-[(2S,3R)-3-(4-nitrophenyl)aziridin-2-yl]methanone.
| Compound Name | (4-nitrophenyl)-[(2S,3R)-3-(4-nitrophenyl)aziridin-2-yl]methanone |
|---|---|
| PubChem CID | 12650827 |
| Molecular Formula | C15H11N3O5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (4-nitrophenyl)-[(2S,3R)-3-(4-nitrophenyl)aziridin-2-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)[C@H]1N[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11N3O5/c19-15(10-3-7-12(8-4-10)18(22)23)14-13(16-14)9-1-5-11(6-2-9)17(20)21/h1-8,13-14,16H/t13-,14+/m1/s1 |
| InChIKey | MDYONHHLJLMUBM-KGLIPLIRSA-N |
| XLogP | 2.40 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|