C24H19N3O3 — CID 124779055
[(1S,2S,3S,10bR)-1-nitro-2-phenyl-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone (PubChem CID 124779055) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is [(1S,2S,3S,10bR)-1-nitro-2-phenyl-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone.
| Compound Name | [(1S,2S,3S,10bR)-1-nitro-2-phenyl-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 124779055 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [(1S,2S,3S,10bR)-1-nitro-2-phenyl-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@H](c2ccccc2)[C@H]([N+](=O)[O-])[C@H]2c3ccccc3C=NN12 |
| InChI | InChI=1S/C24H19N3O3/c28-24(17-11-5-2-6-12-17)23-20(16-9-3-1-4-10-16)22(27(29)30)21-19-14-8-7-13-18(19)15-25-26(21)23/h1-15,20-23H/t20-,21-,22+,23+/m1/s1 |
| InChIKey | AQNMCDPYPROWTM-LUKWVAJMSA-N |
| XLogP | 4.07 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|