C26H24N4O3 — CID 40904619
[(1S,2S,3S,10bS)-2-[4-(dimethylamino)phenyl]-1-nitro-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone (PubChem CID 40904619) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is [(1S,2S,3S,10bS)-2-[4-(dimethylamino)phenyl]-1-nitro-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone.
| Compound Name | [(1S,2S,3S,10bS)-2-[4-(dimethylamino)phenyl]-1-nitro-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 40904619 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [(1S,2S,3S,10bS)-2-[4-(dimethylamino)phenyl]-1-nitro-1,2,3,10b-tetrahydropyrrolo[2,1-a]phthalazin-3-yl]-phenylmethanone |
| SMILES | CN(C)c1ccc([C@@H]2[C@H]([N+](=O)[O-])[C@@H]3c4ccccc4C=NN3[C@@H]2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N4O3/c1-28(2)20-14-12-17(13-15-20)22-24(30(32)33)23-21-11-7-6-10-19(21)16-27-29(23)25(22)26(31)18-8-4-3-5-9-18/h3-16,22-25H,1-2H3/t22-,23+,24+,25+/m1/s1 |
| InChIKey | PRAVMSFPXRPZKR-ROHNOIKCSA-N |
| XLogP | 4.14 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|