C17H16N2O4 — CID 132564270
(2S,3S,4R,5S)-4-nitro-3,5-diphenylpyrrolidine-2-carboxylic acid (PubChem CID 132564270) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is (2S,3S,4R,5S)-4-nitro-3,5-diphenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5S)-4-nitro-3,5-diphenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 132564270 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2S,3S,4R,5S)-4-nitro-3,5-diphenylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1N[C@@H](c2ccccc2)[C@H]([N+](=O)[O-])[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16N2O4/c20-17(21)15-13(11-7-3-1-4-8-11)16(19(22)23)14(18-15)12-9-5-2-6-10-12/h1-10,13-16,18H,(H,20,21)/t13-,14-,15-,16+/m0/s1 |
| InChIKey | QWWGHRVMSZGGKZ-YHUYYLMFSA-N |
| XLogP | 2.21 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|