C22H25ClN2O4 — CID 135027092
tert-butyl (2S,3R,4S,5S)-5-(4-chlorophenyl)-3-(4-methylphenyl)-4-nitropyrrolidine-2-carboxylate (PubChem CID 135027092) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is tert-butyl (2S,3R,4S,5S)-5-(4-chlorophenyl)-3-(4-methylphenyl)-4-nitropyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S,3R,4S,5S)-5-(4-chlorophenyl)-3-(4-methylphenyl)-4-nitropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 135027092 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | tert-butyl (2S,3R,4S,5S)-5-(4-chlorophenyl)-3-(4-methylphenyl)-4-nitropyrrolidine-2-carboxylate |
| SMILES | Cc1ccc([C@H]2[C@H]([N+](=O)[O-])[C@H](c3ccc(Cl)cc3)N[C@@H]2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H25ClN2O4/c1-13-5-7-14(8-6-13)17-19(21(26)29-22(2,3)4)24-18(20(17)25(27)28)15-9-11-16(23)12-10-15/h5-12,17-20,24H,1-4H3/t17-,18+,19+,20+/m1/s1 |
| InChIKey | OCJFUIMAHPWVGR-FYQPLNBISA-N |
| XLogP | 4.43 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|