C18H17ClN2O4 — CID 102053252
methyl (2S,3R,4S,5R)-3-(3-chlorophenyl)-4-nitro-5-phenylpyrrolidine-2-carboxylate (PubChem CID 102053252) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R)-3-(3-chlorophenyl)-4-nitro-5-phenylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R)-3-(3-chlorophenyl)-4-nitro-5-phenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102053252 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl (2S,3R,4S,5R)-3-(3-chlorophenyl)-4-nitro-5-phenylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@H](c2ccccc2)[C@@H]([N+](=O)[O-])[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN2O4/c1-25-18(22)16-14(12-8-5-9-13(19)10-12)17(21(23)24)15(20-16)11-6-3-2-4-7-11/h2-10,14-17,20H,1H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | VAHTZVQIYVMSSZ-NCOADZHNSA-N |
| XLogP | 2.95 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|