C13H11ClN2 — CID 45115080
2-[(2S,3S)-3-(4-chlorophenyl)aziridin-2-yl]pyridine (PubChem CID 45115080) has the molecular formula C13H11ClN2 and a molecular weight of 230.70 g/mol. Its IUPAC name is 2-[(2S,3S)-3-(4-chlorophenyl)aziridin-2-yl]pyridine.
| Compound Name | 2-[(2S,3S)-3-(4-chlorophenyl)aziridin-2-yl]pyridine |
|---|---|
| PubChem CID | 45115080 |
| Molecular Formula | C13H11ClN2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-[(2S,3S)-3-(4-chlorophenyl)aziridin-2-yl]pyridine |
| SMILES | Clc1ccc([C@@H]2N[C@@H]2c2ccccn2)cc1 |
| InChI | InChI=1S/C13H11ClN2/c14-10-6-4-9(5-7-10)12-13(16-12)11-3-1-2-8-15-11/h1-8,12-13,16H/t12-,13+/m0/s1 |
| InChIKey | NCHOENQTWRWQHF-QWHCGFSZSA-N |
| XLogP | 3.12 |
| TPSA | 34.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|