C18H18N6 — CID 3057069
2,4,6-tripyridin-2-yl-1,3,5-triazinane (PubChem CID 3057069) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2,4,6-tripyridin-2-yl-1,3,5-triazinane.
| Compound Name | 2,4,6-tripyridin-2-yl-1,3,5-triazinane |
|---|---|
| PubChem CID | 3057069 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2,4,6-tripyridin-2-yl-1,3,5-triazinane |
| SMILES | c1ccc(C2NC(c3ccccn3)NC(c3ccccn3)N2)nc1 |
| InChI | InChI=1S/C18H18N6/c1-4-10-19-13(7-1)16-22-17(14-8-2-5-11-20-14)24-18(23-16)15-9-3-6-12-21-15/h1-12,16-18,22-24H |
| InChIKey | NUSDIQFUHBVDSL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |