C12H15N3O — CID 75596289
2-pyridin-2-yl-1,2,3,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidin-4-one (PubChem CID 75596289) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-pyridin-2-yl-1,2,3,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidin-4-one.
| Compound Name | 2-pyridin-2-yl-1,2,3,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 75596289 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-pyridin-2-yl-1,2,3,4a,5,6,7,7a-octahydrocyclopenta[d]pyrimidin-4-one |
| SMILES | O=C1NC(c2ccccn2)NC2CCCC12 |
| InChI | InChI=1S/C12H15N3O/c16-12-8-4-3-6-9(8)14-11(15-12)10-5-1-2-7-13-10/h1-2,5,7-9,11,14H,3-4,6H2,(H,15,16) |
| InChIKey | LAIHVYSZEXSKKY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |