C21H33N3O3 — CID 11646502
(1R,4R,9R,12R,17R,20R)-2,10,18-triazatetracyclo[18.4.0.04,9.012,17]tetracosane-3,11,19-trione (PubChem CID 11646502) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is (1R,4R,9R,12R,17R,20R)-2,10,18-triazatetracyclo[18.4.0.04,9.012,17]tetracosane-3,11,19-trione.
| Compound Name | (1R,4R,9R,12R,17R,20R)-2,10,18-triazatetracyclo[18.4.0.04,9.012,17]tetracosane-3,11,19-trione |
|---|---|
| PubChem CID | 11646502 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | (1R,4R,9R,12R,17R,20R)-2,10,18-triazatetracyclo[18.4.0.04,9.012,17]tetracosane-3,11,19-trione |
| SMILES | O=C1N[C@@H]2CCCC[C@H]2C(=O)N[C@@H]2CCCC[C@H]2C(=O)N[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C21H33N3O3/c25-19-13-7-1-4-10-16(13)22-20(26)15-9-3-6-12-18(15)24-21(27)14-8-2-5-11-17(14)23-19/h13-18H,1-12H2,(H,22,26)(H,23,25)(H,24,27)/t13-,14-,15-,16-,17-,18-/m1/s1 |
| InChIKey | KRHKWCDKRHBBLB-TYENPDHQSA-N |
| XLogP | 2.03 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |