C12H20N2O2 — CID 101377557
(11S)-11-methyl-9,12-diazabicyclo[6.5.0]tridecane-10,13-dione (PubChem CID 101377557) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is (11S)-11-methyl-9,12-diazabicyclo[6.5.0]tridecane-10,13-dione.
| Compound Name | (11S)-11-methyl-9,12-diazabicyclo[6.5.0]tridecane-10,13-dione |
|---|---|
| PubChem CID | 101377557 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (11S)-11-methyl-9,12-diazabicyclo[6.5.0]tridecane-10,13-dione |
| SMILES | C[C@@H]1NC(=O)C2CCCCCCC2NC1=O |
| InChI | InChI=1S/C12H20N2O2/c1-8-11(15)14-10-7-5-3-2-4-6-9(10)12(16)13-8/h8-10H,2-7H2,1H3,(H,13,16)(H,14,15)/t8-,9?,10?/m0/s1 |
| InChIKey | CUCLYDVBIMOABJ-IDKOKCKLSA-N |
| XLogP | 0.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |