C9H15NO — CID 131041871
(3R,3aR,7aS)-3-methyl-1,3,3a,4,5,6,7,7a-octahydroindol-2-one (PubChem CID 131041871) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (3R,3aR,7aS)-3-methyl-1,3,3a,4,5,6,7,7a-octahydroindol-2-one.
| Compound Name | (3R,3aR,7aS)-3-methyl-1,3,3a,4,5,6,7,7a-octahydroindol-2-one |
|---|---|
| PubChem CID | 131041871 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3R,3aR,7aS)-3-methyl-1,3,3a,4,5,6,7,7a-octahydroindol-2-one |
| SMILES | C[C@H]1C(=O)N[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C9H15NO/c1-6-7-4-2-3-5-8(7)10-9(6)11/h6-8H,2-5H2,1H3,(H,10,11)/t6-,7-,8+/m1/s1 |
| InChIKey | MJLAOVZVESNDMT-PRJMDXOYSA-N |
| XLogP | 1.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |