C10H17NO2 — CID 131086035
(3S,5aS,9aS)-3-methyl-1,5,5a,6,7,8,9,9a-octahydrobenzo[e][1,4]oxazepin-2-one (PubChem CID 131086035) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (3S,5aS,9aS)-3-methyl-1,5,5a,6,7,8,9,9a-octahydrobenzo[e][1,4]oxazepin-2-one.
| Compound Name | (3S,5aS,9aS)-3-methyl-1,5,5a,6,7,8,9,9a-octahydrobenzo[e][1,4]oxazepin-2-one |
|---|---|
| PubChem CID | 131086035 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (3S,5aS,9aS)-3-methyl-1,5,5a,6,7,8,9,9a-octahydrobenzo[e][1,4]oxazepin-2-one |
| SMILES | C[C@@H]1OC[C@H]2CCCC[C@@H]2NC1=O |
| InChI | InChI=1S/C10H17NO2/c1-7-10(12)11-9-5-3-2-4-8(9)6-13-7/h7-9H,2-6H2,1H3,(H,11,12)/t7-,8+,9-/m0/s1 |
| InChIKey | JXDROGFIHJHERB-YIZRAAEISA-N |
| XLogP | 1.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |