C9H14ClNO — CID 13178864
(4aR,8aR)-3-chloro-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one (PubChem CID 13178864) has the molecular formula C9H14ClNO and a molecular weight of 187.67 g/mol. Its IUPAC name is (4aR,8aR)-3-chloro-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one.
| Compound Name | (4aR,8aR)-3-chloro-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 13178864 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (4aR,8aR)-3-chloro-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
| SMILES | O=C1N[C@@H]2CCCC[C@@H]2CC1Cl |
| InChI | InChI=1S/C9H14ClNO/c10-7-5-6-3-1-2-4-8(6)11-9(7)12/h6-8H,1-5H2,(H,11,12)/t6-,7?,8-/m1/s1 |
| InChIKey | LWHALVREUDNLSQ-OECOWPMFSA-N |
| XLogP | 1.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|