C9H14N2OS — CID 78298951
2-sulfanylidene-1,4a,5,6,7,8,9,9a-octahydrocyclohepta[d]pyrimidin-4-one (PubChem CID 78298951) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-sulfanylidene-1,4a,5,6,7,8,9,9a-octahydrocyclohepta[d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-1,4a,5,6,7,8,9,9a-octahydrocyclohepta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 78298951 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-sulfanylidene-1,4a,5,6,7,8,9,9a-octahydrocyclohepta[d]pyrimidin-4-one |
| SMILES | O=C1NC(=S)NC2CCCCCC12 |
| InChI | InChI=1S/C9H14N2OS/c12-8-6-4-2-1-3-5-7(6)10-9(13)11-8/h6-7H,1-5H2,(H2,10,11,12,13) |
| InChIKey | DHJTXKFZCIEUOW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|