C8H12N2O2 — CID 86227949
1,3,4,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]diazepine-2,5-dione (PubChem CID 86227949) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1,3,4,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]diazepine-2,5-dione.
| Compound Name | 1,3,4,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]diazepine-2,5-dione |
|---|---|
| PubChem CID | 86227949 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1,3,4,5a,6,7,8,8a-octahydrocyclopenta[e][1,4]diazepine-2,5-dione |
| SMILES | O=C1CNC(=O)C2CCCC2N1 |
| InChI | InChI=1S/C8H12N2O2/c11-7-4-9-8(12)5-2-1-3-6(5)10-7/h5-6H,1-4H2,(H,9,12)(H,10,11) |
| InChIKey | GYNNEZKZXMMKCO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |