C10H14N2O3 — CID 67860178
3-(7-oxoazepan-2-yl)pyrrolidine-2,5-dione (PubChem CID 67860178) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-(7-oxoazepan-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(7-oxoazepan-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67860178 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-(7-oxoazepan-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(C2CCCCC(=O)N2)C(=O)N1 |
| InChI | InChI=1S/C10H14N2O3/c13-8-4-2-1-3-7(11-8)6-5-9(14)12-10(6)15/h6-7H,1-5H2,(H,11,13)(H,12,14,15) |
| InChIKey | ZWCDZPROQLAVPB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|