C6H8N2O2 — CID 167096891
3-(aziridin-2-yl)pyrrolidine-2,5-dione (PubChem CID 167096891) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 3-(aziridin-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(aziridin-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167096891 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 3-(aziridin-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(C2CN2)C(=O)N1 |
| InChI | InChI=1S/C6H8N2O2/c9-5-1-3(4-2-7-4)6(10)8-5/h3-4,7H,1-2H2,(H,8,9,10) |
| InChIKey | BBXPFPFJHSWYOH-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|