C10H15NO2 — CID 130729555
3-(2,3-dimethylcyclobutyl)pyrrolidine-2,5-dione (PubChem CID 130729555) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3-(2,3-dimethylcyclobutyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2,3-dimethylcyclobutyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130729555 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3-(2,3-dimethylcyclobutyl)pyrrolidine-2,5-dione |
| SMILES | CC1CC(C2CC(=O)NC2=O)C1C |
| InChI | InChI=1S/C10H15NO2/c1-5-3-7(6(5)2)8-4-9(12)11-10(8)13/h5-8H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | XZJVLZCAEGGKBP-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|