C14H17NO2 — CID 70612312
6-azatetracyclo[10.2.1.02,11.04,9]pentadec-13-ene-5,7-dione (PubChem CID 70612312) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 6-azatetracyclo[10.2.1.02,11.04,9]pentadec-13-ene-5,7-dione.
| Compound Name | 6-azatetracyclo[10.2.1.02,11.04,9]pentadec-13-ene-5,7-dione |
|---|---|
| PubChem CID | 70612312 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 6-azatetracyclo[10.2.1.02,11.04,9]pentadec-13-ene-5,7-dione |
| SMILES | O=C1CC2CC3C4C=CC(C4)C3CC2C(=O)N1 |
| InChI | InChI=1S/C14H17NO2/c16-13-5-9-4-10-7-1-2-8(3-7)11(10)6-12(9)14(17)15-13/h1-2,7-12H,3-6H2,(H,15,16,17) |
| InChIKey | VWUDASOJGHDKPJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|