C15H17NO4S — CID 157420310
3-[(2R)-4-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-2-yl]pyrrolidine-2,5-dione (PubChem CID 157420310) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-[(2R)-4-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(2R)-4-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 157420310 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-[(2R)-4-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-2-yl]pyrrolidine-2,5-dione |
| SMILES | CS(=O)(=O)C1C[C@H](C2CC(=O)NC2=O)Cc2ccccc21 |
| InChI | InChI=1S/C15H17NO4S/c1-21(19,20)13-7-10(12-8-14(17)16-15(12)18)6-9-4-2-3-5-11(9)13/h2-5,10,12-13H,6-8H2,1H3,(H,16,17,18)/t10-,12?,13?/m1/s1 |
| InChIKey | SPJMBHCWIUXQKS-QFWMXSHPSA-N |
| XLogP | 1.00 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|