C8H8N2O5 — CID 141162707
3-(2,5-dioxopyrrolidin-3-yl)-1-hydroxypyrrolidine-2,5-dione (PubChem CID 141162707) has the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-3-yl)-1-hydroxypyrrolidine-2,5-dione.
| Compound Name | 3-(2,5-dioxopyrrolidin-3-yl)-1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 141162707 |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-3-yl)-1-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C1CC(C2CC(=O)N(O)C2=O)C(=O)N1 |
| InChI | InChI=1S/C8H8N2O5/c11-5-1-3(7(13)9-5)4-2-6(12)10(15)8(4)14/h3-4,15H,1-2H2,(H,9,11,13) |
| InChIKey | BLPDQXWPRZHKAE-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|