C8H16ClNO4 — CID 141446961
3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;dihydrate;hydrochloride (PubChem CID 141446961) has the molecular formula C8H16ClNO4 and a molecular weight of 225.67 g/mol. Its IUPAC name is 3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;dihydrate;hydrochloride.
| Compound Name | 3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;dihydrate;hydrochloride |
|---|---|
| PubChem CID | 141446961 |
| Molecular Formula | C8H16ClNO4 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;dihydrate;hydrochloride |
| SMILES | Cl.O.O.O=C1NC(=O)C2CCCCC12 |
| InChI | InChI=1S/C8H11NO2.ClH.2H2O/c10-7-5-3-1-2-4-6(5)8(11)9-7;;;/h5-6H,1-4H2,(H,9,10,11);1H;2*1H2 |
| InChIKey | VEWFYHJLPFXNPS-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|