C13H19NO — CID 124707293
(4aS,9aR)-2,3,4,4a,5,6,7,8,9a,10-decahydro-1H-acridin-9-one (PubChem CID 124707293) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (4aS,9aR)-2,3,4,4a,5,6,7,8,9a,10-decahydro-1H-acridin-9-one.
| Compound Name | (4aS,9aR)-2,3,4,4a,5,6,7,8,9a,10-decahydro-1H-acridin-9-one |
|---|---|
| PubChem CID | 124707293 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (4aS,9aR)-2,3,4,4a,5,6,7,8,9a,10-decahydro-1H-acridin-9-one |
| SMILES | O=C1C2=C(CCCC2)N[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H19NO/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13/h9,11,14H,1-8H2/t9-,11+/m1/s1 |
| InChIKey | XUTRBGAPHUTJQH-KOLCDFICSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |