C10H10O2 — CID 134158456
(3S,6S)-tricyclo[6.2.0.03,6]dec-1(8)-ene-2,7-dione (PubChem CID 134158456) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (3S,6S)-tricyclo[6.2.0.03,6]dec-1(8)-ene-2,7-dione.
| Compound Name | (3S,6S)-tricyclo[6.2.0.03,6]dec-1(8)-ene-2,7-dione |
|---|---|
| PubChem CID | 134158456 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (3S,6S)-tricyclo[6.2.0.03,6]dec-1(8)-ene-2,7-dione |
| SMILES | O=C1C2=C(CC2)C(=O)[C@H]2CC[C@H]12 |
| InChI | InChI=1S/C10H10O2/c11-9-5-1-2-6(5)10(12)8-4-3-7(8)9/h5-6H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | IUQKHKCXIOTZEN-WDSKDSINSA-N |
| XLogP | 1.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |