C9H11NO2 — CID 130030337
2-imino-3a,4,5,6,7,7a-hexahydroindene-1,3-dione (PubChem CID 130030337) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-imino-3a,4,5,6,7,7a-hexahydroindene-1,3-dione.
| Compound Name | 2-imino-3a,4,5,6,7,7a-hexahydroindene-1,3-dione |
|---|---|
| PubChem CID | 130030337 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-imino-3a,4,5,6,7,7a-hexahydroindene-1,3-dione |
| SMILES | [H]N=C1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C9H11NO2/c10-7-8(11)5-3-1-2-4-6(5)9(7)12/h5-6,10H,1-4H2 |
| InChIKey | RGNHKCMKEJOOLZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|