C12H16O2 — CID 605937
tricyclo[5.3.1.12,6]dodecane-11,12-dione (PubChem CID 605937) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is tricyclo[5.3.1.12,6]dodecane-11,12-dione.
| Compound Name | tricyclo[5.3.1.12,6]dodecane-11,12-dione |
|---|---|
| PubChem CID | 605937 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | tricyclo[5.3.1.12,6]dodecane-11,12-dione |
| SMILES | O=C1C2CCCC1C1CCCC2C1=O |
| InChI | InChI=1S/C12H16O2/c13-11-7-3-1-4-8(11)10-6-2-5-9(7)12(10)14/h7-10H,1-6H2 |
| InChIKey | MVMJKWBGQIOQOS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |