C28H38N2O4 — CID 51522264
2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triacontane-5,12,20,27-tetrone (PubChem CID 51522264) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is 2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triacontane-5,12,20,27-tetrone.
| Compound Name | 2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triacontane-5,12,20,27-tetrone |
|---|---|
| PubChem CID | 51522264 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triacontane-5,12,20,27-tetrone |
| SMILES | O=C1C2CCCCC2C(=O)C2C1CCC1NC3C(CCC4C(=O)C5CCCCC5C(=O)C43)NC12 |
| InChI | InChI=1S/C28H38N2O4/c31-25-13-5-1-3-7-15(13)27(33)21-17(25)9-11-19-23(21)29-20-12-10-18-22(24(20)30-19)28(34)16-8-4-2-6-14(16)26(18)32/h13-24,29-30H,1-12H2 |
| InChIKey | DPSBYDJGOBBAKT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |