C11H14O2 — CID 130029184
tricyclo[5.4.0.02,9]undecane-3,8-dione (PubChem CID 130029184) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is tricyclo[5.4.0.02,9]undecane-3,8-dione.
| Compound Name | tricyclo[5.4.0.02,9]undecane-3,8-dione |
|---|---|
| PubChem CID | 130029184 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | tricyclo[5.4.0.02,9]undecane-3,8-dione |
| SMILES | O=C1C2CCCC(=O)C3C1CCC23 |
| InChI | InChI=1S/C11H14O2/c12-9-3-1-2-7-6-4-5-8(10(6)9)11(7)13/h6-8,10H,1-5H2 |
| InChIKey | YXJSECGCDAKVMG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |