C10H16O — CID 10534861
(3aS,7aR)-1-methyl-1,2,3,3a,5,6,7,7a-octahydroinden-4-one (PubChem CID 10534861) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (3aS,7aR)-1-methyl-1,2,3,3a,5,6,7,7a-octahydroinden-4-one.
| Compound Name | (3aS,7aR)-1-methyl-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
|---|---|
| PubChem CID | 10534861 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (3aS,7aR)-1-methyl-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
| SMILES | CC1CC[C@@H]2C(=O)CCC[C@H]12 |
| InChI | InChI=1S/C10H16O/c1-7-5-6-9-8(7)3-2-4-10(9)11/h7-9H,2-6H2,1H3/t7?,8-,9+/m1/s1 |
| InChIKey | IRCBNGIADAIKGQ-ASODMVGOSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |