C10H17NO — CID 163388924
1-methyl-2,3,4,4a,6,7,8,8a-octahydro-1H-isoquinolin-5-one (PubChem CID 163388924) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-methyl-2,3,4,4a,6,7,8,8a-octahydro-1H-isoquinolin-5-one.
| Compound Name | 1-methyl-2,3,4,4a,6,7,8,8a-octahydro-1H-isoquinolin-5-one |
|---|---|
| PubChem CID | 163388924 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-methyl-2,3,4,4a,6,7,8,8a-octahydro-1H-isoquinolin-5-one |
| SMILES | CC1NCCC2C(=O)CCCC12 |
| InChI | InChI=1S/C10H17NO/c1-7-8-3-2-4-10(12)9(8)5-6-11-7/h7-9,11H,2-6H2,1H3 |
| InChIKey | ICNXLQXOPBMXHD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |