C13H22O — CID 59108062
(3aR)-1-[(2S)-butan-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one (PubChem CID 59108062) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (3aR)-1-[(2S)-butan-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one.
| Compound Name | (3aR)-1-[(2S)-butan-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
|---|---|
| PubChem CID | 59108062 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (3aR)-1-[(2S)-butan-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
| SMILES | CC[C@H](C)C1CC[C@H]2C(=O)CCCC12 |
| InChI | InChI=1S/C13H22O/c1-3-9(2)10-7-8-12-11(10)5-4-6-13(12)14/h9-12H,3-8H2,1-2H3/t9-,10?,11?,12+/m0/s1 |
| InChIKey | RICVHBWURSTLQK-WNYYMSAVSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |