C18H30O — CID 90701468
(3aR,7aR)-1-[(2S,5R)-5,6-dimethylhept-3-en-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one (PubChem CID 90701468) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is (3aR,7aR)-1-[(2S,5R)-5,6-dimethylhept-3-en-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one.
| Compound Name | (3aR,7aR)-1-[(2S,5R)-5,6-dimethylhept-3-en-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
|---|---|
| PubChem CID | 90701468 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (3aR,7aR)-1-[(2S,5R)-5,6-dimethylhept-3-en-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
| SMILES | CC(C)[C@@H](C)C=C[C@H](C)C1CC[C@H]2C(=O)CCC[C@H]12 |
| InChI | InChI=1S/C18H30O/c1-12(2)13(3)8-9-14(4)15-10-11-17-16(15)6-5-7-18(17)19/h8-9,12-17H,5-7,10-11H2,1-4H3/t13-,14-,15?,16+,17+/m0/s1 |
| InChIKey | HKDFIZNJOXNUHI-QNXPBFSTSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|