C17H28O — CID 143126717
(3aR,7aR)-1-[(E,2S)-6-methylhept-3-en-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one (PubChem CID 143126717) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (3aR,7aR)-1-[(E,2S)-6-methylhept-3-en-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one.
| Compound Name | (3aR,7aR)-1-[(E,2S)-6-methylhept-3-en-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
|---|---|
| PubChem CID | 143126717 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (3aR,7aR)-1-[(E,2S)-6-methylhept-3-en-2-yl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
| SMILES | CC(C)C/C=C/[C@H](C)C1CC[C@H]2C(=O)CCC[C@H]12 |
| InChI | InChI=1S/C17H28O/c1-12(2)6-4-7-13(3)14-10-11-16-15(14)8-5-9-17(16)18/h4,7,12-16H,5-6,8-11H2,1-3H3/b7-4+/t13-,14?,15+,16+/m0/s1 |
| InChIKey | PVASMZFTZQQPPD-HAPJHLHTSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|