C12H20O2 — CID 11830360
(2S)-2-[(1S,2R)-2-hydroxycyclohexyl]cyclohexan-1-one (PubChem CID 11830360) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (2S)-2-[(1S,2R)-2-hydroxycyclohexyl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(1S,2R)-2-hydroxycyclohexyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 11830360 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2S)-2-[(1S,2R)-2-hydroxycyclohexyl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@H]1[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C12H20O2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h9-11,13H,1-8H2/t9-,10-,11+/m0/s1 |
| InChIKey | OZXHEKGPPPWDHZ-GARJFASQSA-N |
| XLogP | 2.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |