C8H14O3 — CID 102073717
cis-(2R,3S)-2,3-dihydroxycyclooctan-1-one (PubChem CID 102073717) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is cis-(2R,3S)-2,3-dihydroxycyclooctan-1-one.
| Compound Name | cis-(2R,3S)-2,3-dihydroxycyclooctan-1-one |
|---|---|
| PubChem CID | 102073717 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | cis-(2R,3S)-2,3-dihydroxycyclooctan-1-one |
| SMILES | O=C1CCCCC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O3/c9-6-4-2-1-3-5-7(10)8(6)11/h6,8-9,11H,1-5H2/t6-,8+/m0/s1 |
| InChIKey | SUYJNAATTUXRRL-POYBYMJQSA-N |
| XLogP | 0.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |