C11H15IO2 — CID 10924773
9-iodo-3,4,4a,6,7,8,9,9a-octahydro-2H-benzo[7]annulene-1,5-dione (PubChem CID 10924773) has the molecular formula C11H15IO2 and a molecular weight of 306.14 g/mol. Its IUPAC name is 9-iodo-3,4,4a,6,7,8,9,9a-octahydro-2H-benzo[7]annulene-1,5-dione.
| Compound Name | 9-iodo-3,4,4a,6,7,8,9,9a-octahydro-2H-benzo[7]annulene-1,5-dione |
|---|---|
| PubChem CID | 10924773 |
| Molecular Formula | C11H15IO2 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 9-iodo-3,4,4a,6,7,8,9,9a-octahydro-2H-benzo[7]annulene-1,5-dione |
| SMILES | O=C1CCCC(I)C2C(=O)CCCC12 |
| InChI | InChI=1S/C11H15IO2/c12-8-4-2-5-9(13)7-3-1-6-10(14)11(7)8/h7-8,11H,1-6H2 |
| InChIKey | ULVYHEYCZJUHLB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|