About tetracyclo[6.2.1.02,4.05,7]undecan-11-one
tetracyclo[6.2.1.02,4.05,7]undecan-11-one (PubChem CID 130036613) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is tetracyclo[6.2.1.02,4.05,7]undecan-11-one.
Molecular Properties
| Compound Name | tetracyclo[6.2.1.02,4.05,7]undecan-11-one |
| PubChem CID | 130036613 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | tetracyclo[6.2.1.02,4.05,7]undecan-11-one |
| SMILES | O=C1C2CCC1C1CC1C1CC21 |
| InChI | InChI=1S/C11H14O/c12-11-5-1-2-6(11)8-4-10(8)9-3-7(5)9/h5-10H,1-4H2 |
| InChIKey | WSGFTNOXJKZGJR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'} |
|---|
Analyze tetracyclo[6.2.1.02,4.05,7]undecan-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[6.2.1.02,4.05,7]undecan-11-one?
The IUPAC name of tetracyclo[6.2.1.02,4.05,7]undecan-11-one (CID 130036613) is tetracyclo[6.2.1.02,4.05,7]undecan-11-one.
What is the SMILES notation for tetracyclo[6.2.1.02,4.05,7]undecan-11-one?
The canonical SMILES for tetracyclo[6.2.1.02,4.05,7]undecan-11-one is O=C1C2CCC1C1CC1C1CC21.
What is the InChIKey of tetracyclo[6.2.1.02,4.05,7]undecan-11-one?
The InChIKey is WSGFTNOXJKZGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c12-11-5-1-2-6(11)8-4-10(8)9-3-7(5)9/h5-10H,1-4H2.
What are the key properties of tetracyclo[6.2.1.02,4.05,7]undecan-11-one?
tetracyclo[6.2.1.02,4.05,7]undecan-11-one has a molecular weight of 162.23 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[6.2.1.02,4.05,7]undecan-11-one is sourced from PubChem (CID 130036613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).