About (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane
(1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane (PubChem CID 50919070) has the molecular formula C11H14
and a molecular weight of 146.23 g/mol. Its IUPAC name is (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane.
Analyze (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane?
The IUPAC name of (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane (CID 50919070) is (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane.
What is the SMILES notation for (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane?
The canonical SMILES for (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane is C=C1C(=C)[C@@H]2CC[C@H]1[C@@H]1C[C@H]12.
What is the InChIKey of (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane?
The InChIKey is VFIRWPMSWCNRKH-VLEAKVRGSA-N. The full InChI is InChI=1S/C11H14/c1-6-7(2)9-4-3-8(6)10-5-11(9)10/h8-11H,1-5H2/t8-,9+,10-,11-/m0/s1.
What are the key properties of (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane?
(1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane has a molecular weight of 146.23 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R,4R,5R)-6,7-dimethylidenetricyclo[3.2.2.02,4]nonane is sourced from PubChem (CID 50919070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).