C13H20 — CID 123973221
4-methyl-7,8-dimethylidene-1,2,3,4,4a,5,6,8a-octahydronaphthalene (PubChem CID 123973221) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 4-methyl-7,8-dimethylidene-1,2,3,4,4a,5,6,8a-octahydronaphthalene.
| Compound Name | 4-methyl-7,8-dimethylidene-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 123973221 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 4-methyl-7,8-dimethylidene-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| SMILES | C=C1CCC2C(C)CCCC2C1=C |
| InChI | InChI=1S/C13H20/c1-9-7-8-12-10(2)5-4-6-13(12)11(9)3/h10,12-13H,1,3-8H2,2H3 |
| InChIKey | AHHDRBKSRFZPSF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |