C17H26 — CID 123230327
1-methyl-9,10-dimethylidene-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene (PubChem CID 123230327) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 1-methyl-9,10-dimethylidene-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene.
| Compound Name | 1-methyl-9,10-dimethylidene-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene |
|---|---|
| PubChem CID | 123230327 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1-methyl-9,10-dimethylidene-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene |
| SMILES | C=C1C2CCCCC2C(=C)C2C(C)CCCC12 |
| InChI | InChI=1S/C17H26/c1-11-7-6-10-16-12(2)14-8-4-5-9-15(14)13(3)17(11)16/h11,14-17H,2-10H2,1H3 |
| InChIKey | QHQZPBUFOIBLQK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|